C18H15NO5 — CID 4682406
2-phenoxyethyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 4682406) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-phenoxyethyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | 2-phenoxyethyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 4682406 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-phenoxyethyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C18H15NO5/c20-16(24-11-10-23-13-6-2-1-3-7-13)12-19-17(21)14-8-4-5-9-15(14)18(19)22/h1-9H,10-12H2 |
| InChIKey | HJILCVRYHCLWFG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|