C18H16N2O4 — CID 78772613
3-pyridin-3-ylpropyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 78772613) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | 3-pyridin-3-ylpropyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 78772613 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C18H16N2O4/c21-16(24-10-4-6-13-5-3-9-19-11-13)12-20-17(22)14-7-1-2-8-15(14)18(20)23/h1-3,5,7-9,11H,4,6,10,12H2 |
| InChIKey | HEUSVCSEKZLGLF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|