C18H19F2NO3 — CID 78848148
3-pyridin-3-ylpropyl 3-[4-(difluoromethoxy)phenyl]propanoate (PubChem CID 78848148) has the molecular formula C18H19F2NO3 and a molecular weight of 335.35 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 3-[4-(difluoromethoxy)phenyl]propanoate.
| Compound Name | 3-pyridin-3-ylpropyl 3-[4-(difluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 78848148 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3-pyridin-3-ylpropyl 3-[4-(difluoromethoxy)phenyl]propanoate |
| SMILES | O=C(CCc1ccc(OC(F)F)cc1)OCCCc1cccnc1 |
| InChI | InChI=1S/C18H19F2NO3/c19-18(20)24-16-8-5-14(6-9-16)7-10-17(22)23-12-2-4-15-3-1-11-21-13-15/h1,3,5-6,8-9,11,13,18H,2,4,7,10,12H2 |
| InChIKey | DMHNRCJXYYAGFX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|