C17H11ClFNO4 — CID 954150
(2-chloro-6-fluorophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 954150) has the molecular formula C17H11ClFNO4 and a molecular weight of 347.73 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 954150 |
| Molecular Formula | C17H11ClFNO4 |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H11ClFNO4/c18-13-6-3-7-14(19)12(13)9-24-15(21)8-20-16(22)10-4-1-2-5-11(10)17(20)23/h1-7H,8-9H2 |
| InChIKey | DZLLZGSAGLHWNS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|