C14H12ClFN2O5 — CID 2767597
ethyl 2-[3-[(2-chloro-6-fluorophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate (PubChem CID 2767597) has the molecular formula C14H12ClFN2O5 and a molecular weight of 342.71 g/mol. Its IUPAC name is ethyl 2-[3-[(2-chloro-6-fluorophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(2-chloro-6-fluorophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 2767597 |
| Molecular Formula | C14H12ClFN2O5 |
| Molecular Weight | 342.71 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | ethyl 2-[3-[(2-chloro-6-fluorophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)N(Cc2c(F)cccc2Cl)C1=O |
| InChI | InChI=1S/C14H12ClFN2O5/c1-2-23-11(19)7-18-13(21)12(20)17(14(18)22)6-8-9(15)4-3-5-10(8)16/h3-5H,2,6-7H2,1H3 |
| InChIKey | IRPPKFFZNZFWPP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.71 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|