C8H10N2O5 — CID 15096135
ethyl 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetate (PubChem CID 15096135) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is ethyl 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetate.
| Compound Name | ethyl 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 15096135 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | ethyl 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C8H10N2O5/c1-3-15-5(11)4-10-7(13)6(12)9(2)8(10)14/h3-4H2,1-2H3 |
| InChIKey | WSMGRLIAASXYLM-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|