C14H11F3N2O5 — CID 134112876
ethyl 2-[2,4,5-trioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetate (PubChem CID 134112876) has the molecular formula C14H11F3N2O5 and a molecular weight of 344.25 g/mol. Its IUPAC name is ethyl 2-[2,4,5-trioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[2,4,5-trioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 134112876 |
| Molecular Formula | C14H11F3N2O5 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | ethyl 2-[2,4,5-trioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C14H11F3N2O5/c1-2-24-10(20)7-18-11(21)12(22)19(13(18)23)9-5-3-4-8(6-9)14(15,16)17/h3-6H,2,7H2,1H3 |
| InChIKey | JOIHJEVJWZBKDH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|