C24H14As2F6N2O4 — CID 102195126
2,8-dimethyl-5,11-bis[3-(trifluoromethyl)phenyl]-5,11-diaza-2,8-diarsatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-4,6,10,12-tetrone (PubChem CID 102195126) has the molecular formula C24H14As2F6N2O4 and a molecular weight of 658.22 g/mol. Its IUPAC name is 2,8-dimethyl-5,11-bis[3-(trifluoromethyl)phenyl]-5,11-diaza-2,8-diarsatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-4,6,10,12-tetrone.
| Compound Name | 2,8-dimethyl-5,11-bis[3-(trifluoromethyl)phenyl]-5,11-diaza-2,8-diarsatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 102195126 |
| Molecular Formula | C24H14As2F6N2O4 |
| Molecular Weight | 658.22 g/mol |
| Exact Mass | 657.93 |
| IUPAC Name | 2,8-dimethyl-5,11-bis[3-(trifluoromethyl)phenyl]-5,11-diaza-2,8-diarsatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-4,6,10,12-tetrone |
| SMILES | C[As]1C2=C(C(=O)N(c3cccc(C(F)(F)F)c3)C2=O)[As](C)C2=C1C(=O)N(c1cccc(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C24H14As2F6N2O4/c1-25-15-17(21(37)33(19(15)35)13-7-3-5-11(9-13)23(27,28)29)26(2)18-16(25)20(36)34(22(18)38)14-8-4-6-12(10-14)24(30,31)32/h3-10H,1-2H3 |
| InChIKey | BRYYUUFYEBIPNR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|