C13H13F3N2OS — CID 57067232
3,4,4-trimethyl-5-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-2-one (PubChem CID 57067232) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is 3,4,4-trimethyl-5-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-2-one.
| Compound Name | 3,4,4-trimethyl-5-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 57067232 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3,4,4-trimethyl-5-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
| SMILES | CN1C(=O)N(c2cccc(C(F)(F)F)c2)C(=S)C1(C)C |
| InChI | InChI=1S/C13H13F3N2OS/c1-12(2)10(20)18(11(19)17(12)3)9-6-4-5-8(7-9)13(14,15)16/h4-7H,1-3H3 |
| InChIKey | KOIIMEHJEIYRSV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|