C13H12BrF3N2O — CID 141194608
6-bromo-1,5-dimethyl-4-[3-(trifluoromethyl)phenyl]-2H-pyrazin-3-one (PubChem CID 141194608) has the molecular formula C13H12BrF3N2O and a molecular weight of 349.15 g/mol. Its IUPAC name is 6-bromo-1,5-dimethyl-4-[3-(trifluoromethyl)phenyl]-2H-pyrazin-3-one.
| Compound Name | 6-bromo-1,5-dimethyl-4-[3-(trifluoromethyl)phenyl]-2H-pyrazin-3-one |
|---|---|
| PubChem CID | 141194608 |
| Molecular Formula | C13H12BrF3N2O |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 6-bromo-1,5-dimethyl-4-[3-(trifluoromethyl)phenyl]-2H-pyrazin-3-one |
| SMILES | CC1=C(Br)N(C)CC(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12BrF3N2O/c1-8-12(14)18(2)7-11(20)19(8)10-5-3-4-9(6-10)13(15,16)17/h3-6H,7H2,1-2H3 |
| InChIKey | FZASFOZAQVSULY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|