About 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid
3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid (PubChem CID 10384140) has the molecular formula C17H11F3N2O4
and a molecular weight of 364.28 g/mol. Its IUPAC name is 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid |
| PubChem CID | 10384140 |
| Molecular Formula | C17H11F3N2O4 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)CN(c3cccc(C(F)(F)F)c3)C2=O)c1 |
| InChI | InChI=1S/C17H11F3N2O4/c18-17(19,20)11-4-2-5-12(8-11)21-9-14(23)22(16(21)26)13-6-1-3-10(7-13)15(24)25/h1-8H,9H2,(H,24,25) |
| InChIKey | FXDSTCXPQUSHAQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid?
The IUPAC name of 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid (CID 10384140) is 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid.
What is the SMILES notation for 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid?
The canonical SMILES for 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid is O=C(O)c1cccc(N2C(=O)CN(c3cccc(C(F)(F)F)c3)C2=O)c1.
What is the InChIKey of 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid?
The InChIKey is FXDSTCXPQUSHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F3N2O4/c18-17(19,20)11-4-2-5-12(8-11)21-9-14(23)22(16(21)26)13-6-1-3-10(7-13)15(24)25/h1-8H,9H2,(H,24,25).
What are the key properties of 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid?
3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid has a molecular weight of 364.28 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,5-dioxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]benzoic acid is sourced from PubChem (CID 10384140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).