3-(2,5-dioxopiperazin-1-yl)benzoic acid

C11H10N2O4 — CID 82513195

IUPAC3-(2,5-dioxopiperazin-1-yl)benzoic acid
SMILESO=C1CN(c2cccc(C(=O)O)c2)C(=O)CN1
InChIInChI=1S/C11H10N2O4/c14-9-6-13(10(15)5-12-9)8-3-1-2-7(4-8)11(16)17/h1-4H,5-6H2,(H,12,14)(H,16,17)
InChIKeyWIPCAQSBXMFJLO-UHFFFAOYSA-N
MW234.21 g/mol
LogP-0.15
Rot. Bonds2

About 3-(2,5-dioxopiperazin-1-yl)benzoic acid

3-(2,5-dioxopiperazin-1-yl)benzoic acid (PubChem CID 82513195) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-(2,5-dioxopiperazin-1-yl)benzoic acid.

Molecular Properties

Compound Name3-(2,5-dioxopiperazin-1-yl)benzoic acid
PubChem CID82513195
Molecular FormulaC11H10N2O4
Molecular Weight234.21 g/mol
Exact Mass234.06
IUPAC Name3-(2,5-dioxopiperazin-1-yl)benzoic acid
SMILESO=C1CN(c2cccc(C(=O)O)c2)C(=O)CN1
InChIInChI=1S/C11H10N2O4/c14-9-6-13(10(15)5-12-9)8-3-1-2-7(4-8)11(16)17/h1-4H,5-6H2,(H,12,14)(H,16,17)
InChIKeyWIPCAQSBXMFJLO-UHFFFAOYSA-N
XLogP-0.15
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.21
LogP ≤ 5-0.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(2,5-dioxopiperazin-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dioxopiperazin-1-yl)benzoic acid?
The IUPAC name of 3-(2,5-dioxopiperazin-1-yl)benzoic acid (CID 82513195) is 3-(2,5-dioxopiperazin-1-yl)benzoic acid.
What is the SMILES notation for 3-(2,5-dioxopiperazin-1-yl)benzoic acid?
The canonical SMILES for 3-(2,5-dioxopiperazin-1-yl)benzoic acid is O=C1CN(c2cccc(C(=O)O)c2)C(=O)CN1.
What is the InChIKey of 3-(2,5-dioxopiperazin-1-yl)benzoic acid?
The InChIKey is WIPCAQSBXMFJLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O4/c14-9-6-13(10(15)5-12-9)8-3-1-2-7(4-8)11(16)17/h1-4H,5-6H2,(H,12,14)(H,16,17).
What are the key properties of 3-(2,5-dioxopiperazin-1-yl)benzoic acid?
3-(2,5-dioxopiperazin-1-yl)benzoic acid has a molecular weight of 234.21 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopiperazin-1-yl)benzoic acid is sourced from PubChem (CID 82513195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).