C14H16N2O5 — CID 80725798
3-[3-(2-ethoxyethyl)-2,4-dioxoimidazolidin-1-yl]benzoic acid (PubChem CID 80725798) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-[3-(2-ethoxyethyl)-2,4-dioxoimidazolidin-1-yl]benzoic acid.
| Compound Name | 3-[3-(2-ethoxyethyl)-2,4-dioxoimidazolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 80725798 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-[3-(2-ethoxyethyl)-2,4-dioxoimidazolidin-1-yl]benzoic acid |
| SMILES | CCOCCN1C(=O)CN(c2cccc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C14H16N2O5/c1-2-21-7-6-15-12(17)9-16(14(15)20)11-5-3-4-10(8-11)13(18)19/h3-5,8H,2,6-7,9H2,1H3,(H,18,19) |
| InChIKey | KAKKLUOREKUQGN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|