C12H12N2O3 — CID 84695483
1-(2-acetylphenyl)piperazine-2,5-dione (PubChem CID 84695483) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-(2-acetylphenyl)piperazine-2,5-dione.
| Compound Name | 1-(2-acetylphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 84695483 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-(2-acetylphenyl)piperazine-2,5-dione |
| SMILES | CC(=O)c1ccccc1N1CC(=O)NCC1=O |
| InChI | InChI=1S/C12H12N2O3/c1-8(15)9-4-2-3-5-10(9)14-7-11(16)13-6-12(14)17/h2-5H,6-7H2,1H3,(H,13,16) |
| InChIKey | CUJMHGXEHJKUON-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |