C14H15N5O2 — CID 117459419
1-[2-(5-amino-1-methylpyrazol-3-yl)phenyl]piperazine-2,5-dione (PubChem CID 117459419) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-[2-(5-amino-1-methylpyrazol-3-yl)phenyl]piperazine-2,5-dione.
| Compound Name | 1-[2-(5-amino-1-methylpyrazol-3-yl)phenyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 117459419 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[2-(5-amino-1-methylpyrazol-3-yl)phenyl]piperazine-2,5-dione |
| SMILES | Cn1nc(-c2ccccc2N2CC(=O)NCC2=O)cc1N |
| InChI | InChI=1S/C14H15N5O2/c1-18-12(15)6-10(17-18)9-4-2-3-5-11(9)19-8-13(20)16-7-14(19)21/h2-6H,7-8,15H2,1H3,(H,16,20) |
| InChIKey | TXUKTVPJNUXEPU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |