C14H11F3N2O2 — CID 154285486
4-prop-2-ynyl-1-[3-(trifluoromethyl)phenyl]piperazine-2,6-dione (PubChem CID 154285486) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is 4-prop-2-ynyl-1-[3-(trifluoromethyl)phenyl]piperazine-2,6-dione.
| Compound Name | 4-prop-2-ynyl-1-[3-(trifluoromethyl)phenyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 154285486 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-prop-2-ynyl-1-[3-(trifluoromethyl)phenyl]piperazine-2,6-dione |
| SMILES | C#CCN1CC(=O)N(c2cccc(C(F)(F)F)c2)C(=O)C1 |
| InChI | InChI=1S/C14H11F3N2O2/c1-2-6-18-8-12(20)19(13(21)9-18)11-5-3-4-10(7-11)14(15,16)17/h1,3-5,7H,6,8-9H2 |
| InChIKey | SCCZPYGOWXINCJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|