C14H12F3N5O2 — CID 110185662
(1E)-1-[1-(cyanomethyl)-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-ylidene]-3-methylurea (PubChem CID 110185662) has the molecular formula C14H12F3N5O2 and a molecular weight of 339.28 g/mol. Its IUPAC name is (1E)-1-[1-(cyanomethyl)-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-ylidene]-3-methylurea.
| Compound Name | (1E)-1-[1-(cyanomethyl)-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-ylidene]-3-methylurea |
|---|---|
| PubChem CID | 110185662 |
| Molecular Formula | C14H12F3N5O2 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (1E)-1-[1-(cyanomethyl)-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-ylidene]-3-methylurea |
| SMILES | CNC(=O)/N=C1\CN(CC#N)C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3N5O2/c1-19-12(23)20-11-8-21(6-5-18)13(24)22(11)10-4-2-3-9(7-10)14(15,16)17/h2-4,7H,6,8H2,1H3,(H,19,23)/b20-11+ |
| InChIKey | ZXMXPWXQGLSMBJ-RGVLZGJSSA-N |
| XLogP | 2.21 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|