C13H10ArF3N3O — CID 161368992
argon;3-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carbonitrile (PubChem CID 161368992) has the molecular formula C13H10ArF3N3O and a molecular weight of 321.19 g/mol. Its IUPAC name is argon;3-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carbonitrile.
| Compound Name | argon;3-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 161368992 |
| Molecular Formula | C13H10ArF3N3O |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | argon;3-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carbonitrile |
| SMILES | CN1CC(C#N)=CN(c2cccc(C(F)(F)F)c2)C1=O.[Ar] |
| InChI | InChI=1S/C13H10F3N3O.Ar/c1-18-7-9(6-17)8-19(12(18)20)11-4-2-3-10(5-11)13(14,15)16;/h2-5,8H,7H2,1H3; |
| InChIKey | VQFGCBXFFOWQFK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |