C12H5F3N3O2- — CID 51372824
5-cyano-2-oxo-1-[3-(trifluoromethyl)phenyl]pyrimidin-4-olate (PubChem CID 51372824) has the molecular formula C12H5F3N3O2- and a molecular weight of 280.19 g/mol. Its IUPAC name is 5-cyano-2-oxo-1-[3-(trifluoromethyl)phenyl]pyrimidin-4-olate.
| Compound Name | 5-cyano-2-oxo-1-[3-(trifluoromethyl)phenyl]pyrimidin-4-olate |
|---|---|
| PubChem CID | 51372824 |
| Molecular Formula | C12H5F3N3O2- |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 5-cyano-2-oxo-1-[3-(trifluoromethyl)phenyl]pyrimidin-4-olate |
| SMILES | N#Cc1cn(-c2cccc(C(F)(F)F)c2)c(=O)nc1[O-] |
| InChI | InChI=1S/C12H6F3N3O2/c13-12(14,15)8-2-1-3-9(4-8)18-6-7(5-16)10(19)17-11(18)20/h1-4,6H,(H,17,19,20)/p-1 |
| InChIKey | WRRPMKHYWNEDAR-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |