C23H14F3N3O2S — CID 126181300
2-[[(5E)-2,4-dioxo-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126181300) has the molecular formula C23H14F3N3O2S and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-[[(5E)-2,4-dioxo-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-2,4-dioxo-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126181300 |
| Molecular Formula | C23H14F3N3O2S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-[[(5E)-2,4-dioxo-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)S/C(=C/c2cccn2-c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C23H14F3N3O2S/c24-23(25,26)17-7-3-8-18(11-17)28-10-4-9-19(28)12-20-21(30)29(22(31)32-20)14-16-6-2-1-5-15(16)13-27/h1-12H,14H2/b20-12+ |
| InChIKey | YDRSUIOGFBLNRE-UDWIEESQSA-N |
| XLogP | 5.60 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|