C22H14N2O2S — CID 126156427
2-[[(5E)-5-(naphthalen-1-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126156427) has the molecular formula C22H14N2O2S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[[(5E)-5-(naphthalen-1-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-(naphthalen-1-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126156427 |
| Molecular Formula | C22H14N2O2S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[[(5E)-5-(naphthalen-1-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)S/C(=C/c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C22H14N2O2S/c23-13-17-7-1-2-8-18(17)14-24-21(25)20(27-22(24)26)12-16-10-5-9-15-6-3-4-11-19(15)16/h1-12H,14H2/b20-12+ |
| InChIKey | ALVFTEFBTSOWTM-UDWIEESQSA-N |
| XLogP | 4.95 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|