C23H15N3O2S — CID 5227121
2-[[3-[(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 5227121) has the molecular formula C23H15N3O2S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[[3-[(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 5227121 |
| Molecular Formula | C23H15N3O2S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-[[3-[(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | C#CCN1C(=O)SC(=Cc2cn(Cc3ccccc3C#N)c3ccccc23)C1=O |
| InChI | InChI=1S/C23H15N3O2S/c1-2-11-26-22(27)21(29-23(26)28)12-18-15-25(20-10-6-5-9-19(18)20)14-17-8-4-3-7-16(17)13-24/h1,3-10,12,15H,11,14H2 |
| InChIKey | PFJXGGHDVWNGML-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|