C27H19FN2O3S — CID 126230569
(5Z)-5-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 126230569) has the molecular formula C27H19FN2O3S and a molecular weight of 470.53 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126230569 |
| Molecular Formula | C27H19FN2O3S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (5Z)-5-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cn(Cc3ccccc3F)c3ccccc23)C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H19FN2O3S/c28-22-12-6-4-10-19(22)15-29-16-20(21-11-5-7-13-23(21)29)14-25-26(32)30(27(33)34-25)17-24(31)18-8-2-1-3-9-18/h1-14,16H,15,17H2/b25-14- |
| InChIKey | JNFBPEWDNZULDF-QFEZKATASA-N |
| XLogP | 5.75 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|