C23H21FN2O3S — CID 126247699
(5E)-5-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126247699) has the molecular formula C23H21FN2O3S and a molecular weight of 424.50 g/mol. Its IUPAC name is (5E)-5-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126247699 |
| Molecular Formula | C23H21FN2O3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (5E)-5-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COCCCN1C(=O)S/C(=C/c2cn(Cc3ccccc3F)c3ccccc23)C1=O |
| InChI | InChI=1S/C23H21FN2O3S/c1-29-12-6-11-26-22(27)21(30-23(26)28)13-17-15-25(20-10-5-3-8-18(17)20)14-16-7-2-4-9-19(16)24/h2-5,7-10,13,15H,6,11-12,14H2,1H3/b21-13+ |
| InChIKey | YASHHMJDWTWCIS-FYJGNVAPSA-N |
| XLogP | 4.90 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|