C28H18ClN3O3S — CID 126149466
4-[[3-[(Z)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 126149466) has the molecular formula C28H18ClN3O3S and a molecular weight of 511.99 g/mol. Its IUPAC name is 4-[[3-[(Z)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[3-[(Z)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126149466 |
| Molecular Formula | C28H18ClN3O3S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | 4-[[3-[(Z)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2cc(/C=C3\SC(=O)N(CC(=O)c4ccc(Cl)cc4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H18ClN3O3S/c29-22-11-9-20(10-12-22)25(33)17-32-27(34)26(36-28(32)35)13-21-16-31(24-4-2-1-3-23(21)24)15-19-7-5-18(14-30)6-8-19/h1-13,16H,15,17H2/b26-13- |
| InChIKey | ZLBTYLIPFLLQIF-ZMFRSBBQSA-N |
| XLogP | 6.13 |
| TPSA | 83.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|