C27H20ClN3O4S2 — CID 126134489
2-[3-[(Z)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126134489) has the molecular formula C27H20ClN3O4S2 and a molecular weight of 550.06 g/mol. Its IUPAC name is 2-[3-[(Z)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(Z)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126134489 |
| Molecular Formula | C27H20ClN3O4S2 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 2-[3-[(Z)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=O)N(CC(=O)c3ccc(Cl)cc3)C2=O)c2ccccc21)NCc1cccs1 |
| InChI | InChI=1S/C27H20ClN3O4S2/c28-19-9-7-17(8-10-19)23(32)15-31-26(34)24(37-27(31)35)12-18-14-30(22-6-2-1-5-21(18)22)16-25(33)29-13-20-4-3-11-36-20/h1-12,14H,13,15-16H2,(H,29,33)/b24-12- |
| InChIKey | IQJSDHPBTZVUNX-MSXFZWOLSA-N |
| XLogP | 5.59 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|