C27H23N3O3S2 — CID 126153218
2-[3-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126153218) has the molecular formula C27H23N3O3S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-[3-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126153218 |
| Molecular Formula | C27H23N3O3S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-[3-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=O)N(CCc3ccccc3)C2=O)c2ccccc21)NCc1cccs1 |
| InChI | InChI=1S/C27H23N3O3S2/c31-25(28-16-21-9-6-14-34-21)18-29-17-20(22-10-4-5-11-23(22)29)15-24-26(32)30(27(33)35-24)13-12-19-7-2-1-3-8-19/h1-11,14-15,17H,12-13,16,18H2,(H,28,31)/b24-15- |
| InChIKey | TZYDYDOLQSGKCO-IWIPYMOSSA-N |
| XLogP | 5.30 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|