C21H20N4O2S2 — CID 44714175
2-[3-[(Z)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 44714175) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[3-[(Z)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(Z)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 44714175 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[3-[(Z)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CN1C(=O)/C(=C/c2cn(CC(=O)NCc3cccs3)c3ccccc23)N(C)C1=S |
| InChI | InChI=1S/C21H20N4O2S2/c1-23-18(20(27)24(2)21(23)28)10-14-12-25(17-8-4-3-7-16(14)17)13-19(26)22-11-15-6-5-9-29-15/h3-10,12H,11,13H2,1-2H3,(H,22,26)/b18-10- |
| InChIKey | YYMSYAVINFNMSB-ZDLGFXPLSA-N |
| XLogP | 3.05 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|