C26H20BrClN4O2S2 — CID 126143357
2-[5-bromo-3-[(Z)-[1-(4-chlorophenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126143357) has the molecular formula C26H20BrClN4O2S2 and a molecular weight of 599.96 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-[1-(4-chlorophenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-[1-(4-chlorophenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126143357 |
| Molecular Formula | C26H20BrClN4O2S2 |
| Molecular Weight | 599.96 g/mol |
| Exact Mass | 597.99 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-[1-(4-chlorophenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CN1C(=S)N(c2ccc(Cl)cc2)C(=O)/C1=C/c1cn(CC(=O)NCc2cccs2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C26H20BrClN4O2S2/c1-30-23(25(34)32(26(30)35)19-7-5-18(28)6-8-19)11-16-14-31(22-9-4-17(27)12-21(16)22)15-24(33)29-13-20-3-2-10-36-20/h2-12,14H,13,15H2,1H3,(H,29,33)/b23-11- |
| InChIKey | UVZPOCFYEPXGEQ-KSEXSDGBSA-N |
| XLogP | 6.04 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.96 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|