C27H27BrN4O2S — CID 126152462
(5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126152462) has the molecular formula C27H27BrN4O2S and a molecular weight of 551.51 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126152462 |
| Molecular Formula | C27H27BrN4O2S |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C[C@H]1CCCCN1C(=O)Cn1cc(/C=C2/C(=O)N(c3ccccc3)C(=S)N2C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C27H27BrN4O2S/c1-18-8-6-7-13-31(18)25(33)17-30-16-19(22-15-20(28)11-12-23(22)30)14-24-26(34)32(27(35)29(24)2)21-9-4-3-5-10-21/h3-5,9-12,14-16,18H,6-8,13,17H2,1-2H3/b24-14-/t18-/m0/s1 |
| InChIKey | RXSPQZJCHYBVIH-SMNNTEATSA-N |
| XLogP | 5.41 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|