C29H30BrN3O3S — CID 126148100
(5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126148100) has the molecular formula C29H30BrN3O3S and a molecular weight of 580.55 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126148100 |
| Molecular Formula | C29H30BrN3O3S |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@H]1CCCCN1C(=O)Cn1cc(/C=C2\SC(=O)N(CCCc3ccccc3)C2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C29H30BrN3O3S/c1-20-8-5-6-14-32(20)27(34)19-31-18-22(24-17-23(30)12-13-25(24)31)16-26-28(35)33(29(36)37-26)15-7-11-21-9-3-2-4-10-21/h2-4,9-10,12-13,16-18,20H,5-8,11,14-15,19H2,1H3/b26-16-/t20-/m0/s1 |
| InChIKey | WUMFZTQXXLEHQB-ZWXNIRCYSA-N |
| XLogP | 6.47 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|