C28H28BrN3O2S2 — CID 126155170
(5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126155170) has the molecular formula C28H28BrN3O2S2 and a molecular weight of 582.59 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126155170 |
| Molecular Formula | C28H28BrN3O2S2 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C[C@H]1CCCCN1C(=O)Cn1cc(/C=C2\SC(=S)N(CCc3ccccc3)C2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C28H28BrN3O2S2/c1-19-7-5-6-13-31(19)26(33)18-30-17-21(23-16-22(29)10-11-24(23)30)15-25-27(34)32(28(35)36-25)14-12-20-8-3-2-4-9-20/h2-4,8-11,15-17,19H,5-7,12-14,18H2,1H3/b25-15-/t19-/m0/s1 |
| InChIKey | TVYGWJVIZXVLCH-QETRNLNESA-N |
| XLogP | 6.25 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|