C24H28BrN3O3S — CID 126141056
(5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126141056) has the molecular formula C24H28BrN3O3S and a molecular weight of 518.48 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126141056 |
| Molecular Formula | C24H28BrN3O3S |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)CN1C(=O)S/C(=C\c2cn(CC(=O)N3CCCC[C@@H]3C)c3ccc(Br)cc23)C1=O |
| InChI | InChI=1S/C24H28BrN3O3S/c1-15(2)12-28-23(30)21(32-24(28)31)10-17-13-26(20-8-7-18(25)11-19(17)20)14-22(29)27-9-5-4-6-16(27)3/h7-8,10-11,13,15-16H,4-6,9,12,14H2,1-3H3/b21-10-/t16-/m0/s1 |
| InChIKey | PQIBGEIJNGHJEH-QZPXRHMKSA-N |
| XLogP | 5.50 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|