C21H24BrN3O4S — CID 126155093
2-[5-bromo-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 126155093) has the molecular formula C21H24BrN3O4S and a molecular weight of 494.41 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 126155093 |
| Molecular Formula | C21H24BrN3O4S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1cc(/C=C2\SC(=O)N(CC(C)C)C2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C21H24BrN3O4S/c1-13(2)10-25-20(27)18(30-21(25)28)8-14-11-24(12-19(26)23-6-7-29-3)17-5-4-15(22)9-16(14)17/h4-5,8-9,11,13H,6-7,10,12H2,1-3H3,(H,23,26)/b18-8- |
| InChIKey | RZSNQVFIBDAQIQ-LSCVHKIXSA-N |
| XLogP | 3.86 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|