C25H23Br2N3O4S — CID 126134977
2-[5-bromo-3-[(Z)-[3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 126134977) has the molecular formula C25H23Br2N3O4S and a molecular weight of 621.35 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-[3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-[3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 126134977 |
| Molecular Formula | C25H23Br2N3O4S |
| Molecular Weight | 621.35 g/mol |
| Exact Mass | 618.98 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-[3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)Cn1cc(/C=C2\SC(=O)N(Cc3ccc(Br)cc3)C2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C25H23Br2N3O4S/c1-34-10-2-9-28-23(31)15-29-14-17(20-12-19(27)7-8-21(20)29)11-22-24(32)30(25(33)35-22)13-16-3-5-18(26)6-4-16/h3-8,11-12,14H,2,9-10,13,15H2,1H3,(H,28,31)/b22-11- |
| InChIKey | GGNZIZMLUNJWDO-JJFYIABZSA-N |
| XLogP | 5.56 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|