C23H17BrCl2N2O4S — CID 126155081
ethyl 2-[5-bromo-3-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetate (PubChem CID 126155081) has the molecular formula C23H17BrCl2N2O4S and a molecular weight of 568.28 g/mol. Its IUPAC name is ethyl 2-[5-bromo-3-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[5-bromo-3-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 126155081 |
| Molecular Formula | C23H17BrCl2N2O4S |
| Molecular Weight | 568.28 g/mol |
| Exact Mass | 565.95 |
| IUPAC Name | ethyl 2-[5-bromo-3-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(/C=C2\SC(=O)N(Cc3ccc(Cl)c(Cl)c3)C2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C23H17BrCl2N2O4S/c1-2-32-21(29)12-27-11-14(16-9-15(24)4-6-19(16)27)8-20-22(30)28(23(31)33-20)10-13-3-5-17(25)18(26)7-13/h3-9,11H,2,10,12H2,1H3/b20-8- |
| InChIKey | RWEFPCTVJAZCAC-ZBKNUEDVSA-N |
| XLogP | 6.51 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.28 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|