C28H19BrCl2N2O5S — CID 126136250
(5Z)-5-[[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindol-3-yl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126136250) has the molecular formula C28H19BrCl2N2O5S and a molecular weight of 646.35 g/mol. Its IUPAC name is (5Z)-5-[[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindol-3-yl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindol-3-yl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126136250 |
| Molecular Formula | C28H19BrCl2N2O5S |
| Molecular Weight | 646.35 g/mol |
| Exact Mass | 643.96 |
| IUPAC Name | (5Z)-5-[[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindol-3-yl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cn(CCOc3ccc4c(c3)OCO4)c3ccc(Br)cc23)C(=O)N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H19BrCl2N2O5S/c29-18-2-5-23-20(11-18)17(14-32(23)7-8-36-19-3-6-24-25(12-19)38-15-37-24)10-26-27(34)33(28(35)39-26)13-16-1-4-21(30)22(31)9-16/h1-6,9-12,14H,7-8,13,15H2/b26-10- |
| InChIKey | VLZXPRBWXLOEAE-KALUYTGESA-N |
| XLogP | 7.75 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.35 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|