C18H14BrNO4 — CID 988460
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindole-3-carbaldehyde (PubChem CID 988460) has the molecular formula C18H14BrNO4 and a molecular weight of 388.22 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindole-3-carbaldehyde.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindole-3-carbaldehyde |
|---|---|
| PubChem CID | 988460 |
| Molecular Formula | C18H14BrNO4 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindole-3-carbaldehyde |
| SMILES | O=Cc1cn(CCOc2ccc3c(c2)OCO3)c2ccc(Br)cc12 |
| InChI | InChI=1S/C18H14BrNO4/c19-13-1-3-16-15(7-13)12(10-21)9-20(16)5-6-22-14-2-4-17-18(8-14)24-11-23-17/h1-4,7-10H,5-6,11H2 |
| InChIKey | KNAZXPHZZPKLGK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|