C22H22N2O4S — CID 50895894
[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]indol-3-yl]-morpholin-4-ylmethanethione (PubChem CID 50895894) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is [1-[2-(1,3-benzodioxol-5-yloxy)ethyl]indol-3-yl]-morpholin-4-ylmethanethione.
| Compound Name | [1-[2-(1,3-benzodioxol-5-yloxy)ethyl]indol-3-yl]-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 50895894 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [1-[2-(1,3-benzodioxol-5-yloxy)ethyl]indol-3-yl]-morpholin-4-ylmethanethione |
| SMILES | S=C(c1cn(CCOc2ccc3c(c2)OCO3)c2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C22H22N2O4S/c29-22(23-7-10-25-11-8-23)18-14-24(19-4-2-1-3-17(18)19)9-12-26-16-5-6-20-21(13-16)28-15-27-20/h1-6,13-14H,7-12,15H2 |
| InChIKey | HEYJLYTUBJDIHG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|