C27H20BrN3O4S — CID 126146372
(5Z)-5-[[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126146372) has the molecular formula C27H20BrN3O4S and a molecular weight of 562.45 g/mol. Its IUPAC name is (5Z)-5-[[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126146372 |
| Molecular Formula | C27H20BrN3O4S |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | (5Z)-5-[[1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-bromoindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2cn(CCOc3ccc4c(c3)OCO4)c3ccc(Br)cc23)NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C27H20BrN3O4S/c28-18-6-8-23-21(13-18)17(12-22-26(32)31(27(36)29-22)19-4-2-1-3-5-19)15-30(23)10-11-33-20-7-9-24-25(14-20)35-16-34-24/h1-9,12-15H,10-11,16H2,(H,29,36)/b22-12- |
| InChIKey | CSYVCWMMXYSYPA-UUYOSTAYSA-N |
| XLogP | 5.47 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|