C28H24BrN3O3S — CID 126144339
(5Z)-5-[[5-bromo-1-(2-phenoxyethyl)indol-3-yl]methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 126144339) has the molecular formula C28H24BrN3O3S and a molecular weight of 562.49 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-(2-phenoxyethyl)indol-3-yl]methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-(2-phenoxyethyl)indol-3-yl]methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126144339 |
| Molecular Formula | C28H24BrN3O3S |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-(2-phenoxyethyl)indol-3-yl]methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cn(CCOc4ccccc4)c4ccc(Br)cc34)NC2=S)cc1 |
| InChI | InChI=1S/C28H24BrN3O3S/c1-2-34-23-11-9-21(10-12-23)32-27(33)25(30-28(32)36)16-19-18-31(26-13-8-20(29)17-24(19)26)14-15-35-22-6-4-3-5-7-22/h3-13,16-18H,2,14-15H2,1H3,(H,30,36)/b25-16- |
| InChIKey | ZGPLOOWKRAJKJH-XYGWBWBKSA-N |
| XLogP | 6.14 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|