C28H25N3O2S — CID 44714159
(5Z)-3-(3,4-dimethylphenyl)-5-[[1-(2-phenoxyethyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 44714159) has the molecular formula C28H25N3O2S and a molecular weight of 467.59 g/mol. Its IUPAC name is (5Z)-3-(3,4-dimethylphenyl)-5-[[1-(2-phenoxyethyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(3,4-dimethylphenyl)-5-[[1-(2-phenoxyethyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 44714159 |
| Molecular Formula | C28H25N3O2S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (5Z)-3-(3,4-dimethylphenyl)-5-[[1-(2-phenoxyethyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3cn(CCOc4ccccc4)c4ccccc34)NC2=S)cc1C |
| InChI | InChI=1S/C28H25N3O2S/c1-19-12-13-22(16-20(19)2)31-27(32)25(29-28(31)34)17-21-18-30(26-11-7-6-10-24(21)26)14-15-33-23-8-4-3-5-9-23/h3-13,16-18H,14-15H2,1-2H3,(H,29,34)/b25-17- |
| InChIKey | HYMGZPZYHSFXRK-UQQQWYQISA-N |
| XLogP | 5.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|