C26H28N4O2S — CID 44714048
2-[3-[(Z)-[1-(3,4-dimethylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]indol-1-yl]-N,N-diethylacetamide (PubChem CID 44714048) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[3-[(Z)-[1-(3,4-dimethylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]indol-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[3-[(Z)-[1-(3,4-dimethylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]indol-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 44714048 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[3-[(Z)-[1-(3,4-dimethylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]indol-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(/C=C2\NC(=S)N(c3ccc(C)c(C)c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C26H28N4O2S/c1-5-28(6-2)24(31)16-29-15-19(21-9-7-8-10-23(21)29)14-22-25(32)30(26(33)27-22)20-12-11-17(3)18(4)13-20/h7-15H,5-6,16H2,1-4H3,(H,27,33)/b22-14- |
| InChIKey | SJDBAZRPJKIPGZ-HMAPJEAMSA-N |
| XLogP | 4.39 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|