C15H14O3S — CID 79404002
5-(2-phenylsulfanylethoxy)-1,3-benzodioxole (PubChem CID 79404002) has the molecular formula C15H14O3S and a molecular weight of 274.34 g/mol. Its IUPAC name is 5-(2-phenylsulfanylethoxy)-1,3-benzodioxole.
| Compound Name | 5-(2-phenylsulfanylethoxy)-1,3-benzodioxole |
|---|---|
| PubChem CID | 79404002 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 5-(2-phenylsulfanylethoxy)-1,3-benzodioxole |
| SMILES | c1ccc(SCCOc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C15H14O3S/c1-2-4-13(5-3-1)19-9-8-16-12-6-7-14-15(10-12)18-11-17-14/h1-7,10H,8-9,11H2 |
| InChIKey | ZMJCNBTXRWVXAT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|