C12H15NO3 — CID 107391556
3-[2-(1,3-benzodioxol-5-yloxy)ethyl]azetidine (PubChem CID 107391556) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]azetidine.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]azetidine |
|---|---|
| PubChem CID | 107391556 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]azetidine |
| SMILES | c1cc2c(cc1OCCC1CNC1)OCO2 |
| InChI | InChI=1S/C12H15NO3/c1-2-11-12(16-8-15-11)5-10(1)14-4-3-9-6-13-7-9/h1-2,5,9,13H,3-4,6-8H2 |
| InChIKey | PVHXENYLYJFWOH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |