About 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane (PubChem CID 82091513) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane |
| PubChem CID | 82091513 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane |
| SMILES | c1cc2c(cc1OCCN1CCCNCC1)OCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-4-15-5-7-16(6-1)8-9-17-12-2-3-13-14(10-12)19-11-18-13/h2-3,10,15H,1,4-9,11H2 |
| InChIKey | CDQOOJNLXDRXMF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane?
The IUPAC name of 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane (CID 82091513) is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane.
What is the SMILES notation for 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane?
The canonical SMILES for 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane is c1cc2c(cc1OCCN1CCCNCC1)OCO2.
What is the InChIKey of 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane?
The InChIKey is CDQOOJNLXDRXMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-4-15-5-7-16(6-1)8-9-17-12-2-3-13-14(10-12)19-11-18-13/h2-3,10,15H,1,4-9,11H2.
What are the key properties of 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane?
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane has a molecular weight of 264.32 g/mol, XLogP of 1.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1,4-diazepane is sourced from PubChem (CID 82091513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).