C13H18Cl2N2O — CID 43162548
1-[2-(2,6-dichlorophenoxy)ethyl]-1,4-diazepane (PubChem CID 43162548) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenoxy)ethyl]-1,4-diazepane.
| Compound Name | 1-[2-(2,6-dichlorophenoxy)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 43162548 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-[2-(2,6-dichlorophenoxy)ethyl]-1,4-diazepane |
| SMILES | Clc1cccc(Cl)c1OCCN1CCCNCC1 |
| InChI | InChI=1S/C13H18Cl2N2O/c14-11-3-1-4-12(15)13(11)18-10-9-17-7-2-5-16-6-8-17/h1,3-4,16H,2,5-10H2 |
| InChIKey | LFVYEQBOIZSGAG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |