C15H22Cl2N2O2 — CID 2299248
1-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]ethyl]piperazine (PubChem CID 2299248) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 1-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]ethyl]piperazine.
| Compound Name | 1-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 2299248 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]ethyl]piperazine |
| SMILES | Cc1cc(Cl)c(OCCOCCN2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O2/c1-12-10-13(16)15(14(17)11-12)21-9-8-20-7-6-19-4-2-18-3-5-19/h10-11,18H,2-9H2,1H3 |
| InChIKey | UXGCOSBPOYSYCP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|