C18H30N2O3 — CID 10853299
4-[2-[2-(1,4-diazepan-1-yl)ethoxy]ethoxy]-2,3,6-trimethylphenol (PubChem CID 10853299) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-[2-[2-(1,4-diazepan-1-yl)ethoxy]ethoxy]-2,3,6-trimethylphenol.
| Compound Name | 4-[2-[2-(1,4-diazepan-1-yl)ethoxy]ethoxy]-2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 10853299 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 4-[2-[2-(1,4-diazepan-1-yl)ethoxy]ethoxy]-2,3,6-trimethylphenol |
| SMILES | Cc1cc(OCCOCCN2CCCNCC2)c(C)c(C)c1O |
| InChI | InChI=1S/C18H30N2O3/c1-14-13-17(15(2)16(3)18(14)21)23-12-11-22-10-9-20-7-4-5-19-6-8-20/h13,19,21H,4-12H2,1-3H3 |
| InChIKey | CGUQVQFUCXSSIF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|