C15H25ClN2O2 — CID 119906010
1-[2-(2-ethoxyphenoxy)ethyl]-1,4-diazepane;hydrochloride (PubChem CID 119906010) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-[2-(2-ethoxyphenoxy)ethyl]-1,4-diazepane;hydrochloride.
| Compound Name | 1-[2-(2-ethoxyphenoxy)ethyl]-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 119906010 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[2-(2-ethoxyphenoxy)ethyl]-1,4-diazepane;hydrochloride |
| SMILES | CCOc1ccccc1OCCN1CCCNCC1.Cl |
| InChI | InChI=1S/C15H24N2O2.ClH/c1-2-18-14-6-3-4-7-15(14)19-13-12-17-10-5-8-16-9-11-17;/h3-4,6-7,16H,2,5,8-13H2,1H3;1H |
| InChIKey | FCUBOSLWPXKVMH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |